C17H20N8O2 — CID 25023722
4-[7-(3-aminopropoxy)-1-ethyl-4-(1H-pyrrol-3-yl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 25023722) has the molecular formula C17H20N8O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 4-[7-(3-aminopropoxy)-1-ethyl-4-(1H-pyrrol-3-yl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[7-(3-aminopropoxy)-1-ethyl-4-(1H-pyrrol-3-yl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 25023722 |
| Molecular Formula | C17H20N8O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 4-[7-(3-aminopropoxy)-1-ethyl-4-(1H-pyrrol-3-yl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CCn1c(-c2nonc2N)nc2c(-c3cc[nH]c3)ncc(OCCCN)c21 |
| InChI | InChI=1S/C17H20N8O2/c1-2-25-15-11(26-7-3-5-18)9-21-12(10-4-6-20-8-10)13(15)22-17(25)14-16(19)24-27-23-14/h4,6,8-9,20H,2-3,5,7,18H2,1H3,(H2,19,24) |
| InChIKey | BFFORFSCMCLHMJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|