About 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone
1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone (PubChem CID 25023808) has the molecular formula C15H11F2NO2S
and a molecular weight of 307.32 g/mol. Its IUPAC name is 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone |
| PubChem CID | 25023808 |
| Molecular Formula | C15H11F2NO2S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone |
| SMILES | O=C(c1ccc(C(=O)N2CCc3ccccc32)s1)C(F)F |
| InChI | InChI=1S/C15H11F2NO2S/c16-14(17)13(19)11-5-6-12(21-11)15(20)18-8-7-9-3-1-2-4-10(9)18/h1-6,14H,7-8H2 |
| InChIKey | WZGNPOPOCGTSMZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone?
The IUPAC name of 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone (CID 25023808) is 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone.
What is the SMILES notation for 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone?
The canonical SMILES for 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone is O=C(c1ccc(C(=O)N2CCc3ccccc32)s1)C(F)F.
What is the InChIKey of 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone?
The InChIKey is WZGNPOPOCGTSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2NO2S/c16-14(17)13(19)11-5-6-12(21-11)15(20)18-8-7-9-3-1-2-4-10(9)18/h1-6,14H,7-8H2.
What are the key properties of 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone?
1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone has a molecular weight of 307.32 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,3-dihydroindole-1-carbonyl)thiophen-2-yl]-2,2-difluoroethanone is sourced from PubChem (CID 25023808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).