C16H18F3NO2 — CID 25023821
N-(cyclohexylmethyl)-3-(2,2,2-trifluoroacetyl)benzamide (PubChem CID 25023821) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-(2,2,2-trifluoroacetyl)benzamide.
| Compound Name | N-(cyclohexylmethyl)-3-(2,2,2-trifluoroacetyl)benzamide |
|---|---|
| PubChem CID | 25023821 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(cyclohexylmethyl)-3-(2,2,2-trifluoroacetyl)benzamide |
| SMILES | O=C(NCC1CCCCC1)c1cccc(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3NO2/c17-16(18,19)14(21)12-7-4-8-13(9-12)15(22)20-10-11-5-2-1-3-6-11/h4,7-9,11H,1-3,5-6,10H2,(H,20,22) |
| InChIKey | OFHDOSVGGCZRGV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |