About N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide
N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 25023855) has the molecular formula C20H22N4OS
and a molecular weight of 366.49 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 25023855 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCNCc1cnc(-c2ccc(C(=O)Nc3ccccc3N)cc2)s1 |
| InChI | InChI=1S/C20H22N4OS/c1-2-11-22-12-16-13-23-20(26-16)15-9-7-14(8-10-15)19(25)24-18-6-4-3-5-17(18)21/h3-10,13,22H,2,11-12,21H2,1H3,(H,24,25) |
| InChIKey | VDVPSIREDHINBU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide?
The IUPAC name of N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide (CID 25023855) is N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide is CCCNCc1cnc(-c2ccc(C(=O)Nc3ccccc3N)cc2)s1.
What is the InChIKey of N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide?
The InChIKey is VDVPSIREDHINBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4OS/c1-2-11-22-12-16-13-23-20(26-16)15-9-7-14(8-10-15)19(25)24-18-6-4-3-5-17(18)21/h3-10,13,22H,2,11-12,21H2,1H3,(H,24,25).
What are the key properties of N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide?
N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide has a molecular weight of 366.49 g/mol, XLogP of 4.14, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)-4-[5-(propylaminomethyl)-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 25023855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).