C17H31NO7P2 — CID 25023874
[2-[3-(3,7-dimethyloctoxy)pyridin-1-ium-1-yl]-1-phosphonoethyl]-hydroxyphosphinate (PubChem CID 25023874) has the molecular formula C17H31NO7P2 and a molecular weight of 423.38 g/mol. Its IUPAC name is [2-[3-(3,7-dimethyloctoxy)pyridin-1-ium-1-yl]-1-phosphonoethyl]-hydroxyphosphinate.
| Compound Name | [2-[3-(3,7-dimethyloctoxy)pyridin-1-ium-1-yl]-1-phosphonoethyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 25023874 |
| Molecular Formula | C17H31NO7P2 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2-[3-(3,7-dimethyloctoxy)pyridin-1-ium-1-yl]-1-phosphonoethyl]-hydroxyphosphinate |
| SMILES | CC(C)CCCC(C)CCOc1ccc[n+](CC(P(=O)([O-])O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C17H31NO7P2/c1-14(2)6-4-7-15(3)9-11-25-16-8-5-10-18(12-16)13-17(26(19,20)21)27(22,23)24/h5,8,10,12,14-15,17H,4,6-7,9,11,13H2,1-3H3,(H3-,19,20,21,22,23,24) |
| InChIKey | WHQLUYYDOZYPJB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|