C18H13Cl2NO2 — CID 25023972
2-(2,4-dichlorophenoxy)-5-(pyridin-3-ylmethyl)phenol (PubChem CID 25023972) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-5-(pyridin-3-ylmethyl)phenol.
| Compound Name | 2-(2,4-dichlorophenoxy)-5-(pyridin-3-ylmethyl)phenol |
|---|---|
| PubChem CID | 25023972 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-5-(pyridin-3-ylmethyl)phenol |
| SMILES | Oc1cc(Cc2cccnc2)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2NO2/c19-14-4-6-17(15(20)10-14)23-18-5-3-12(9-16(18)22)8-13-2-1-7-21-11-13/h1-7,9-11,22H,8H2 |
| InChIKey | WAXFANKFAQHYIV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |