C18H16N4OS — CID 25024284
2-(3H-benzimidazol-5-yl)-5-(3-phenylpropylsulfanyl)-1,3,4-oxadiazole (PubChem CID 25024284) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-(3H-benzimidazol-5-yl)-5-(3-phenylpropylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3H-benzimidazol-5-yl)-5-(3-phenylpropylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 25024284 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-(3H-benzimidazol-5-yl)-5-(3-phenylpropylsulfanyl)-1,3,4-oxadiazole |
| SMILES | c1ccc(CCCSc2nnc(-c3ccc4nc[nH]c4c3)o2)cc1 |
| InChI | InChI=1S/C18H16N4OS/c1-2-5-13(6-3-1)7-4-10-24-18-22-21-17(23-18)14-8-9-15-16(11-14)20-12-19-15/h1-3,5-6,8-9,11-12H,4,7,10H2,(H,19,20) |
| InChIKey | PLZCJCOQBAAQPL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|