C33H44FN3O3 — CID 25024422
ethyl (2S,3S)-3-[[1-cyclohexyl-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]-4-methylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 25024422) has the molecular formula C33H44FN3O3 and a molecular weight of 549.73 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[1-cyclohexyl-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]-4-methylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[1-cyclohexyl-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]-4-methylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 25024422 |
| Molecular Formula | C33H44FN3O3 |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | ethyl (2S,3S)-3-[[1-cyclohexyl-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]-4-methylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2CCC(C)(C2)[C@H]1NC(=O)c1nn(C2CCCCC2)c2c1CCCCC2Cc1cccc(F)c1 |
| InChI | InChI=1S/C33H44FN3O3/c1-3-40-32(39)27-23-16-17-33(2,20-23)30(27)35-31(38)28-26-15-8-7-11-22(18-21-10-9-12-24(34)19-21)29(26)37(36-28)25-13-5-4-6-14-25/h9-10,12,19,22-23,25,27,30H,3-8,11,13-18,20H2,1-2H3,(H,35,38)/t22?,23?,27-,30-,33?/m0/s1 |
| InChIKey | AHPOKUDFJTYHIO-JHIZIOEISA-N |
| XLogP | 6.68 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |