About 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole
3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole (PubChem CID 25024928) has the molecular formula C19H18ClF2N3O2S
and a molecular weight of 425.89 g/mol. Its IUPAC name is 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole.
Molecular Properties
| Compound Name | 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole |
| PubChem CID | 25024928 |
| Molecular Formula | C19H18ClF2N3O2S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole |
| SMILES | O=S(=O)(c1ccc(F)cc1F)n1cc(Cl)c2cc(CN3CCNCC3)ccc21 |
| InChI | InChI=1S/C19H18ClF2N3O2S/c20-16-12-25(28(26,27)19-4-2-14(21)10-17(19)22)18-3-1-13(9-15(16)18)11-24-7-5-23-6-8-24/h1-4,9-10,12,23H,5-8,11H2 |
| InChIKey | YUKIKOBMXGRCTM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole?
The IUPAC name of 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole (CID 25024928) is 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole.
What is the SMILES notation for 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole?
The canonical SMILES for 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole is O=S(=O)(c1ccc(F)cc1F)n1cc(Cl)c2cc(CN3CCNCC3)ccc21.
What is the InChIKey of 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole?
The InChIKey is YUKIKOBMXGRCTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClF2N3O2S/c20-16-12-25(28(26,27)19-4-2-14(21)10-17(19)22)18-3-1-13(9-15(16)18)11-24-7-5-23-6-8-24/h1-4,9-10,12,23H,5-8,11H2.
What are the key properties of 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole?
3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole has a molecular weight of 425.89 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-(2,4-difluorophenyl)sulfonyl-5-(piperazin-1-ylmethyl)indole is sourced from PubChem (CID 25024928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).