C32H36F3N3O — CID 25025015
1-(2,4-difluorophenyl)-8-[(3-fluorophenyl)methyl]-N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide (PubChem CID 25025015) has the molecular formula C32H36F3N3O and a molecular weight of 535.65 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-8-[(3-fluorophenyl)methyl]-N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-8-[(3-fluorophenyl)methyl]-N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 25025015 |
| Molecular Formula | C32H36F3N3O |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 1-(2,4-difluorophenyl)-8-[(3-fluorophenyl)methyl]-N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
| SMILES | CC12CCC(C1)C(C)(C)[C@H]2NC(=O)c1nn(-c2ccc(F)cc2F)c2c1CCCCC2Cc1cccc(F)c1 |
| InChI | InChI=1S/C32H36F3N3O/c1-31(2)21-13-14-32(3,18-21)30(31)36-29(39)27-24-10-5-4-8-20(15-19-7-6-9-22(33)16-19)28(24)38(37-27)26-12-11-23(34)17-25(26)35/h6-7,9,11-12,16-17,20-21,30H,4-5,8,10,13-15,18H2,1-3H3,(H,36,39)/t20?,21?,30-,32?/m1/s1 |
| InChIKey | QJFLGJGXIALCPH-UQKFXCHMSA-N |
| XLogP | 7.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |