C30H42ClN5O4S — CID 25025486
5-[[[1-[1-(6-chloro-2,4-dimethylpyridine-3-carbonyl)-4-methylpiperidin-4-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]pentanoic acid (PubChem CID 25025486) has the molecular formula C30H42ClN5O4S and a molecular weight of 604.22 g/mol. Its IUPAC name is 5-[[[1-[1-(6-chloro-2,4-dimethylpyridine-3-carbonyl)-4-methylpiperidin-4-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]pentanoic acid.
| Compound Name | 5-[[[1-[1-(6-chloro-2,4-dimethylpyridine-3-carbonyl)-4-methylpiperidin-4-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 25025486 |
| Molecular Formula | C30H42ClN5O4S |
| Molecular Weight | 604.22 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | 5-[[[1-[1-(6-chloro-2,4-dimethylpyridine-3-carbonyl)-4-methylpiperidin-4-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]pentanoic acid |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)N1CCC(C)(N2CCC(N(Cc3ccsc3)C(=O)NCCCCC(=O)O)CC2)CC1 |
| InChI | InChI=1S/C30H42ClN5O4S/c1-21-18-25(31)33-22(2)27(21)28(39)34-15-10-30(3,11-16-34)35-13-7-24(8-14-35)36(19-23-9-17-41-20-23)29(40)32-12-5-4-6-26(37)38/h9,17-18,20,24H,4-8,10-16,19H2,1-3H3,(H,32,40)(H,37,38) |
| InChIKey | UIFFVZXEHLDWRK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.22 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|