C29H24ClFN6O — CID 25026310
N-[4-[[[7-(2-chloro-3-pyridinyl)-2-(dimethylamino)quinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide (PubChem CID 25026310) has the molecular formula C29H24ClFN6O and a molecular weight of 527.00 g/mol. Its IUPAC name is N-[4-[[[7-(2-chloro-3-pyridinyl)-2-(dimethylamino)quinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[[[7-(2-chloro-3-pyridinyl)-2-(dimethylamino)quinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 25026310 |
| Molecular Formula | C29H24ClFN6O |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N-[4-[[[7-(2-chloro-3-pyridinyl)-2-(dimethylamino)quinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide |
| SMILES | CN(C)c1nc(NCc2ccc(NC(=O)c3ccc(F)cc3)cc2)c2ccc(-c3cccnc3Cl)cc2n1 |
| InChI | InChI=1S/C29H24ClFN6O/c1-37(2)29-35-25-16-20(23-4-3-15-32-26(23)30)9-14-24(25)27(36-29)33-17-18-5-12-22(13-6-18)34-28(38)19-7-10-21(31)11-8-19/h3-16H,17H2,1-2H3,(H,34,38)(H,33,35,36) |
| InChIKey | KNYUKCDFZOGMCJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|