C25H23ClN6O — CID 25026714
6-chloro-N-[4-[[[2-(dimethylamino)-6-ethenylquinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 25026714) has the molecular formula C25H23ClN6O and a molecular weight of 458.95 g/mol. Its IUPAC name is 6-chloro-N-[4-[[[2-(dimethylamino)-6-ethenylquinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[[[2-(dimethylamino)-6-ethenylquinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25026714 |
| Molecular Formula | C25H23ClN6O |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 6-chloro-N-[4-[[[2-(dimethylamino)-6-ethenylquinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | C=Cc1ccc2nc(N(C)C)nc(NCc3ccc(NC(=O)c4ccc(Cl)nc4)cc3)c2c1 |
| InChI | InChI=1S/C25H23ClN6O/c1-4-16-7-11-21-20(13-16)23(31-25(30-21)32(2)3)28-14-17-5-9-19(10-6-17)29-24(33)18-8-12-22(26)27-15-18/h4-13,15H,1,14H2,2-3H3,(H,29,33)(H,28,30,31) |
| InChIKey | SACAWJSUCOAUFA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|