C23H21ClN6O — CID 25027105
6-chloro-N-[4-[[[8-methyl-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 25027105) has the molecular formula C23H21ClN6O and a molecular weight of 432.92 g/mol. Its IUPAC name is 6-chloro-N-[4-[[[8-methyl-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[[[8-methyl-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25027105 |
| Molecular Formula | C23H21ClN6O |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 6-chloro-N-[4-[[[8-methyl-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | CNc1nc(NCc2ccc(NC(=O)c3ccc(Cl)nc3)cc2)c2cccc(C)c2n1 |
| InChI | InChI=1S/C23H21ClN6O/c1-14-4-3-5-18-20(14)29-23(25-2)30-21(18)27-12-15-6-9-17(10-7-15)28-22(31)16-8-11-19(24)26-13-16/h3-11,13H,12H2,1-2H3,(H,28,31)(H2,25,27,29,30) |
| InChIKey | QSUMUOAPGNILCM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|