C20H38N4O6 — CID 25027466
1,3,4,6-tetrakis(2-ethoxyethyl)-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 25027466) has the molecular formula C20H38N4O6 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1,3,4,6-tetrakis(2-ethoxyethyl)-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 1,3,4,6-tetrakis(2-ethoxyethyl)-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 25027466 |
| Molecular Formula | C20H38N4O6 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 1,3,4,6-tetrakis(2-ethoxyethyl)-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | CCOCCN1C(=O)N(CCOCC)C2C1N(CCOCC)C(=O)N2CCOCC |
| InChI | InChI=1S/C20H38N4O6/c1-5-27-13-9-21-17-18(23(19(21)25)11-15-29-7-3)24(12-16-30-8-4)20(26)22(17)10-14-28-6-2/h17-18H,5-16H2,1-4H3 |
| InChIKey | ZXUSCCIGYRWMKQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|