C15H15NO2 — CID 25027904
3-(4-hydroxyphenyl)-1,2,3,4-tetrahydroquinolin-7-ol (PubChem CID 25027904) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-1,2,3,4-tetrahydroquinolin-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-1,2,3,4-tetrahydroquinolin-7-ol |
|---|---|
| PubChem CID | 25027904 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-(4-hydroxyphenyl)-1,2,3,4-tetrahydroquinolin-7-ol |
| SMILES | Oc1ccc(C2CNc3cc(O)ccc3C2)cc1 |
| InChI | InChI=1S/C15H15NO2/c17-13-4-1-10(2-5-13)12-7-11-3-6-14(18)8-15(11)16-9-12/h1-6,8,12,16-18H,7,9H2 |
| InChIKey | GKAXYWNIEDJCER-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |