C18H16NNaO4S — CID 25028163
sodium 4-[3-(3,4,5-trimethoxyphenyl)-1,2-thiazol-4-yl]phenolate (PubChem CID 25028163) has the molecular formula C18H16NNaO4S and a molecular weight of 365.39 g/mol. Its IUPAC name is sodium 4-[3-(3,4,5-trimethoxyphenyl)-1,2-thiazol-4-yl]phenolate.
| Compound Name | sodium 4-[3-(3,4,5-trimethoxyphenyl)-1,2-thiazol-4-yl]phenolate |
|---|---|
| PubChem CID | 25028163 |
| Molecular Formula | C18H16NNaO4S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | sodium 4-[3-(3,4,5-trimethoxyphenyl)-1,2-thiazol-4-yl]phenolate |
| SMILES | COc1cc(-c2nscc2-c2ccc([O-])cc2)cc(OC)c1OC.[Na+] |
| InChI | InChI=1S/C18H17NO4S.Na/c1-21-15-8-12(9-16(22-2)18(15)23-3)17-14(10-24-19-17)11-4-6-13(20)7-5-11;/h4-10,20H,1-3H3;/q;+1/p-1 |
| InChIKey | XDNFOHYCIOWSKM-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |