About 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid
4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid (PubChem CID 25028236) has the molecular formula C13H7FIN3O2
and a molecular weight of 383.12 g/mol. Its IUPAC name is 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid |
| PubChem CID | 25028236 |
| Molecular Formula | C13H7FIN3O2 |
| Molecular Weight | 383.12 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc3ncc(F)c(I)c3[nH]2)cc1 |
| InChI | InChI=1S/C13H7FIN3O2/c14-8-5-16-12-10(9(8)15)17-11(18-12)6-1-3-7(4-2-6)13(19)20/h1-5H,(H,19,20)(H,16,17,18) |
| InChIKey | PHUUDHMIGQMCMW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.12 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid?
The IUPAC name of 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid (CID 25028236) is 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid.
What is the SMILES notation for 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid?
The canonical SMILES for 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid is O=C(O)c1ccc(-c2nc3ncc(F)c(I)c3[nH]2)cc1.
What is the InChIKey of 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid?
The InChIKey is PHUUDHMIGQMCMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7FIN3O2/c14-8-5-16-12-10(9(8)15)17-11(18-12)6-1-3-7(4-2-6)13(19)20/h1-5H,(H,19,20)(H,16,17,18).
What are the key properties of 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid?
4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid has a molecular weight of 383.12 g/mol, XLogP of 3.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluoro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid is sourced from PubChem (CID 25028236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).