C22H28FN7O — CID 25028470
4-[2-[[4-(5-aminopentylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]phenol (PubChem CID 25028470) has the molecular formula C22H28FN7O and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-[2-[[4-(5-aminopentylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-(5-aminopentylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 25028470 |
| Molecular Formula | C22H28FN7O |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4-[2-[[4-(5-aminopentylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]phenol |
| SMILES | NCCCCCNc1nc(NCCc2ccc(O)cc2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H28FN7O/c23-17-6-8-18(9-7-17)27-22-29-20(25-14-3-1-2-13-24)28-21(30-22)26-15-12-16-4-10-19(31)11-5-16/h4-11,31H,1-3,12-15,24H2,(H3,25,26,27,28,29,30) |
| InChIKey | RURWKISHIOLFSG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|