C29H31F6NO3 — CID 25029154
[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-cyclopropylmethanone (PubChem CID 25029154) has the molecular formula C29H31F6NO3 and a molecular weight of 555.56 g/mol. Its IUPAC name is [(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-cyclopropylmethanone.
| Compound Name | [(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 25029154 |
| Molecular Formula | C29H31F6NO3 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | [(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-cyclopropylmethanone |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(C(=O)C3CC3)C[C@H]2CC[C@@H]1O[C@H](CO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H31F6NO3/c1-16-4-2-3-5-22(16)26-23-14-36(27(38)17-6-7-17)13-18(23)8-9-24(26)39-25(15-37)19-10-20(28(30,31)32)12-21(11-19)29(33,34)35/h2-5,10-12,17-18,23-26,37H,6-9,13-15H2,1H3/t18-,23-,24+,25-,26+/m1/s1 |
| InChIKey | MMEVBPDDWFFJMA-BEGWYFQMSA-N |
| XLogP | 6.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |