C27H25F7N2O4 — CID 25029387
2-[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-oxazol-4-one (PubChem CID 25029387) has the molecular formula C27H25F7N2O4 and a molecular weight of 574.49 g/mol. Its IUPAC name is 2-[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-oxazol-4-one.
| Compound Name | 2-[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 25029387 |
| Molecular Formula | C27H25F7N2O4 |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 2-[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-oxazol-4-one |
| SMILES | O=C1COC(N2C[C@H]3CC[C@H](O[C@H](CO)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)[C@@H](c4ccc(F)cc4)[C@@H]3C2)=N1 |
| InChI | InChI=1S/C27H25F7N2O4/c28-19-4-1-14(2-5-19)24-20-11-36(25-35-23(38)13-39-25)10-15(20)3-6-21(24)40-22(12-37)16-7-17(26(29,30)31)9-18(8-16)27(32,33)34/h1-2,4-5,7-9,15,20-22,24,37H,3,6,10-13H2/t15-,20-,21+,22-,24+/m1/s1 |
| InChIKey | UPPCMJMYNCSRJF-OIQDKXCASA-N |
| XLogP | 5.32 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |