C28H27F7N2O4 — CID 25029388
2-[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluoro-2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-oxazol-4-one (PubChem CID 25029388) has the molecular formula C28H27F7N2O4 and a molecular weight of 588.52 g/mol. Its IUPAC name is 2-[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluoro-2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-oxazol-4-one.
| Compound Name | 2-[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluoro-2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 25029388 |
| Molecular Formula | C28H27F7N2O4 |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | 2-[(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluoro-2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-oxazol-4-one |
| SMILES | Cc1cc(F)ccc1[C@H]1[C@@H]2CN(C3=NC(=O)CO3)C[C@H]2CC[C@@H]1O[C@H](CO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H27F7N2O4/c1-14-6-19(29)3-4-20(14)25-21-11-37(26-36-24(39)13-40-26)10-15(21)2-5-22(25)41-23(12-38)16-7-17(27(30,31)32)9-18(8-16)28(33,34)35/h3-4,6-9,15,21-23,25,38H,2,5,10-13H2,1H3/t15-,21-,22+,23-,25+/m1/s1 |
| InChIKey | YEVSJZWBRIGSKF-GSTIINNISA-N |
| XLogP | 5.63 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |