C17H21N3O2S — CID 25029543
3-(2,2-dioxo-1-phenyl-4H-2λ6,1,3-benzothiadiazin-3-yl)-N-methylpropan-1-amine (PubChem CID 25029543) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-(2,2-dioxo-1-phenyl-4H-2λ6,1,3-benzothiadiazin-3-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,2-dioxo-1-phenyl-4H-2λ6,1,3-benzothiadiazin-3-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 25029543 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-(2,2-dioxo-1-phenyl-4H-2λ6,1,3-benzothiadiazin-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCN1Cc2ccccc2N(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C17H21N3O2S/c1-18-12-7-13-19-14-15-8-5-6-11-17(15)20(23(19,21)22)16-9-3-2-4-10-16/h2-6,8-11,18H,7,12-14H2,1H3 |
| InChIKey | UBBWGPMMVOSPDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|