C18H23N3O3S — CID 25029546
3-[1-(3-methoxyphenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine (PubChem CID 25029546) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 3-[1-(3-methoxyphenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[1-(3-methoxyphenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 25029546 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-[1-(3-methoxyphenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1Cc2ccccc2N(c2cccc(OC)c2)S1(=O)=O |
| InChI | InChI=1S/C18H23N3O3S/c1-19-11-6-12-20-14-15-7-3-4-10-18(15)21(25(20,22)23)16-8-5-9-17(13-16)24-2/h3-5,7-10,13,19H,6,11-12,14H2,1-2H3 |
| InChIKey | ZFGMAUXPSXKTKJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|