C17H20ClN3O2S — CID 25029547
3-[1-(4-chlorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine (PubChem CID 25029547) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[1-(4-chlorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 25029547 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 3-[1-(4-chlorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1Cc2ccccc2N(c2ccc(Cl)cc2)S1(=O)=O |
| InChI | InChI=1S/C17H20ClN3O2S/c1-19-11-4-12-20-13-14-5-2-3-6-17(14)21(24(20,22)23)16-9-7-15(18)8-10-16/h2-3,5-10,19H,4,11-13H2,1H3 |
| InChIKey | HDTINEVDGKNACJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|