C28H32F6N2O3 — CID 25029856
(3aR,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-N,N-dimethyl-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 25029856) has the molecular formula C28H32F6N2O3 and a molecular weight of 558.56 g/mol. Its IUPAC name is (3aR,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-N,N-dimethyl-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aR,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-N,N-dimethyl-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 25029856 |
| Molecular Formula | C28H32F6N2O3 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (3aR,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-N,N-dimethyl-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(C(=O)N(C)C)C[C@H]2CC[C@@H]1O[C@@H](CO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H32F6N2O3/c1-16-6-4-5-7-21(16)25-22-14-36(26(38)35(2)3)13-17(22)8-9-23(25)39-24(15-37)18-10-19(27(29,30)31)12-20(11-18)28(32,33)34/h4-7,10-12,17,22-25,37H,8-9,13-15H2,1-3H3/t17-,22-,23+,24+,25+/m1/s1 |
| InChIKey | QGDZSJXKVXDPFB-MFASFYCRSA-N |
| XLogP | 6.26 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |