C12H19NO6 — CID 25029947
2,2-dimethyl-5-(4-methyl-1-nitropentan-2-yl)-1,3-dioxane-4,6-dione (PubChem CID 25029947) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2,2-dimethyl-5-(4-methyl-1-nitropentan-2-yl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(4-methyl-1-nitropentan-2-yl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 25029947 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2,2-dimethyl-5-(4-methyl-1-nitropentan-2-yl)-1,3-dioxane-4,6-dione |
| SMILES | CC(C)CC(C[N+](=O)[O-])C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C12H19NO6/c1-7(2)5-8(6-13(16)17)9-10(14)18-12(3,4)19-11(9)15/h7-9H,5-6H2,1-4H3 |
| InChIKey | FVQALALXVHXLPY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|