C18H22FN3O2S — CID 25030029
4-[1-(2-fluorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylbutan-1-amine (PubChem CID 25030029) has the molecular formula C18H22FN3O2S and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-[1-(2-fluorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylbutan-1-amine.
| Compound Name | 4-[1-(2-fluorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 25030029 |
| Molecular Formula | C18H22FN3O2S |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[1-(2-fluorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylbutan-1-amine |
| SMILES | CNCCCCN1Cc2ccccc2N(c2ccccc2F)S1(=O)=O |
| InChI | InChI=1S/C18H22FN3O2S/c1-20-12-6-7-13-21-14-15-8-2-4-10-17(15)22(25(21,23)24)18-11-5-3-9-16(18)19/h2-5,8-11,20H,6-7,12-14H2,1H3 |
| InChIKey | OWEYOMCWVMSOQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|