C17H19F2N3O2S — CID 25030033
3-[6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine (PubChem CID 25030033) has the molecular formula C17H19F2N3O2S and a molecular weight of 367.42 g/mol. Its IUPAC name is 3-[6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 25030033 |
| Molecular Formula | C17H19F2N3O2S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1Cc2cc(F)ccc2N(c2ccccc2F)S1(=O)=O |
| InChI | InChI=1S/C17H19F2N3O2S/c1-20-9-4-10-21-12-13-11-14(18)7-8-16(13)22(25(21,23)24)17-6-3-2-5-15(17)19/h2-3,5-8,11,20H,4,9-10,12H2,1H3 |
| InChIKey | PITDIXLZXHYFAC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|