About [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone
[4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone (PubChem CID 25030040) has the molecular formula C19H12Cl2O3
and a molecular weight of 359.21 g/mol. Its IUPAC name is [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone |
| PubChem CID | 25030040 |
| Molecular Formula | C19H12Cl2O3 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(O)c(-c2cc(Cl)cc(Cl)c2)c(O)c1 |
| InChI | InChI=1S/C19H12Cl2O3/c20-14-6-12(7-15(21)10-14)18-16(22)8-13(9-17(18)23)19(24)11-4-2-1-3-5-11/h1-10,22-23H |
| InChIKey | CRNLOOZHRPDURJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone?
The IUPAC name of [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone (CID 25030040) is [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone.
What is the SMILES notation for [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone?
The canonical SMILES for [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone is O=C(c1ccccc1)c1cc(O)c(-c2cc(Cl)cc(Cl)c2)c(O)c1.
What is the InChIKey of [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone?
The InChIKey is CRNLOOZHRPDURJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2O3/c20-14-6-12(7-15(21)10-14)18-16(22)8-13(9-17(18)23)19(24)11-4-2-1-3-5-11/h1-10,22-23H.
What are the key properties of [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone?
[4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone has a molecular weight of 359.21 g/mol, XLogP of 5.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone is sourced from PubChem (CID 25030040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).