About tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate
tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate (PubChem CID 25030231) has the molecular formula C25H26FNO6S2
and a molecular weight of 519.62 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate |
| PubChem CID | 25030231 |
| Molecular Formula | C25H26FNO6S2 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26FNO6S2/c1-24(2,3)33-23(28)27-22(19-13-7-4-8-14-19)25(26,34(29,30)20-15-9-5-10-16-20)35(31,32)21-17-11-6-12-18-21/h4-18,22H,1-3H3,(H,27,28)/t22-/m0/s1 |
| InChIKey | FLJSAZFACSWIEX-QFIPXVFZSA-N |
| XLogP | 4.82 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate?
The IUPAC name of tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate (CID 25030231) is tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate?
The canonical SMILES for tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate is CC(C)(C)OC(=O)N[C@@H](c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate?
The InChIKey is FLJSAZFACSWIEX-QFIPXVFZSA-N. The full InChI is InChI=1S/C25H26FNO6S2/c1-24(2,3)33-23(28)27-22(19-13-7-4-8-14-19)25(26,34(29,30)20-15-9-5-10-16-20)35(31,32)21-17-11-6-12-18-21/h4-18,22H,1-3H3,(H,27,28)/t22-/m0/s1.
What are the key properties of tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate?
tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate has a molecular weight of 519.62 g/mol, XLogP of 4.82, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate is sourced from PubChem (CID 25030231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).