C25H26FNO6S2 — CID 25030231
tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate (PubChem CID 25030231) has the molecular formula C25H26FNO6S2 and a molecular weight of 519.62 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 25030231 |
| Molecular Formula | C25H26FNO6S2 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26FNO6S2/c1-24(2,3)33-23(28)27-22(19-13-7-4-8-14-19)25(26,34(29,30)20-15-9-5-10-16-20)35(31,32)21-17-11-6-12-18-21/h4-18,22H,1-3H3,(H,27,28)/t22-/m0/s1 |
| InChIKey | FLJSAZFACSWIEX-QFIPXVFZSA-N |
| XLogP | 4.82 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |