C23H18F3N3O5S — CID 25030413
N-[2,4-difluoro-3-[5-(2-methoxyethoxy)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-3-fluorobenzenesulfonamide (PubChem CID 25030413) has the molecular formula C23H18F3N3O5S and a molecular weight of 505.47 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[5-(2-methoxyethoxy)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[2,4-difluoro-3-[5-(2-methoxyethoxy)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 25030413 |
| Molecular Formula | C23H18F3N3O5S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | N-[2,4-difluoro-3-[5-(2-methoxyethoxy)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-3-fluorobenzenesulfonamide |
| SMILES | COCCOc1cnc2[nH]cc(C(=O)c3c(F)ccc(NS(=O)(=O)c4cccc(F)c4)c3F)c2c1 |
| InChI | InChI=1S/C23H18F3N3O5S/c1-33-7-8-34-14-10-16-17(12-28-23(16)27-11-14)22(30)20-18(25)5-6-19(21(20)26)29-35(31,32)15-4-2-3-13(24)9-15/h2-6,9-12,29H,7-8H2,1H3,(H,27,28) |
| InChIKey | PEFJDHZODJWAAQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|