About 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol
4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol (PubChem CID 25031059) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol |
| PubChem CID | 25031059 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol |
| SMILES | CCc1cccc(CC)c1-c1c(S)nnn1-c1ccc(O)cc1O |
| InChI | InChI=1S/C18H19N3O2S/c1-3-11-6-5-7-12(4-2)16(11)17-18(24)19-20-21(17)14-9-8-13(22)10-15(14)23/h5-10,22-24H,3-4H2,1-2H3 |
| InChIKey | JTODPTADEPPHBY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol?
The IUPAC name of 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol (CID 25031059) is 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol.
What is the SMILES notation for 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol?
The canonical SMILES for 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol is CCc1cccc(CC)c1-c1c(S)nnn1-c1ccc(O)cc1O.
What is the InChIKey of 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol?
The InChIKey is JTODPTADEPPHBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-3-11-6-5-7-12(4-2)16(11)17-18(24)19-20-21(17)14-9-8-13(22)10-15(14)23/h5-10,22-24H,3-4H2,1-2H3.
What are the key properties of 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol?
4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol has a molecular weight of 341.44 g/mol, XLogP of 3.76, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,6-diethylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol is sourced from PubChem (CID 25031059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).