C18H17N3O2S — CID 25031145
4-[4-sulfanyl-5-(5,6,7,8-tetrahydronaphthalen-1-yl)triazol-1-yl]benzene-1,3-diol (PubChem CID 25031145) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-[4-sulfanyl-5-(5,6,7,8-tetrahydronaphthalen-1-yl)triazol-1-yl]benzene-1,3-diol.
| Compound Name | 4-[4-sulfanyl-5-(5,6,7,8-tetrahydronaphthalen-1-yl)triazol-1-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 25031145 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-[4-sulfanyl-5-(5,6,7,8-tetrahydronaphthalen-1-yl)triazol-1-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-n2nnc(S)c2-c2cccc3c2CCCC3)c(O)c1 |
| InChI | InChI=1S/C18H17N3O2S/c22-12-8-9-15(16(23)10-12)21-17(18(24)19-20-21)14-7-3-5-11-4-1-2-6-13(11)14/h3,5,7-10,22-24H,1-2,4,6H2 |
| InChIKey | LLHQBJNAVFDQQI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|