C29H39ClN8O4 — CID 25031171
3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 25031171) has the molecular formula C29H39ClN8O4 and a molecular weight of 599.14 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 25031171 |
| Molecular Formula | C29H39ClN8O4 |
| Molecular Weight | 599.14 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(CCCCNC[C@H](O)c2ccc(O)c(CO)c2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C29H39ClN8O4/c30-25-27(32)37-26(31)24(36-25)28(42)38-29(33)35-14-4-2-6-19-9-7-18(8-10-19)5-1-3-13-34-16-23(41)20-11-12-22(40)21(15-20)17-39/h7-12,15,23,34,39-41H,1-6,13-14,16-17H2,(H4,31,32,37)(H3,33,35,38,42)/t23-/m0/s1 |
| InChIKey | CQMZNTMBNGQGAR-QHCPKHFHSA-N |
| XLogP | 2.21 |
| TPSA | 218.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|