C38H49ClN8O7 — CID 25031172
3,5-diamino-N-[N'-[4-[4-[4-[bis[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 25031172) has the molecular formula C38H49ClN8O7 and a molecular weight of 765.31 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[4-[bis[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[4-[bis[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 25031172 |
| Molecular Formula | C38H49ClN8O7 |
| Molecular Weight | 765.31 g/mol |
| Exact Mass | 764.34 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[4-[bis[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(CCCCN(C[C@H](O)c2ccc(O)c(CO)c2)C[C@H](O)c2ccc(O)c(CO)c2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C38H49ClN8O7/c39-34-36(41)45-35(40)33(44-34)37(54)46-38(42)43-15-3-1-5-23-7-9-24(10-8-23)6-2-4-16-47(19-31(52)25-11-13-29(50)27(17-25)21-48)20-32(53)26-12-14-30(51)28(18-26)22-49/h7-14,17-18,31-32,48-53H,1-6,15-16,19-22H2,(H4,40,41,45)(H3,42,43,46,54)/t31-,32-/m0/s1 |
| InChIKey | JSEOGMLOXFQEPB-ACHIHNKUSA-N |
| XLogP | 2.85 |
| TPSA | 269.92 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|