C21H16N4O7 — CID 2503190
[2-[(3-nitrobenzoyl)amino]-2-oxoethyl] 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate (PubChem CID 2503190) has the molecular formula C21H16N4O7 and a molecular weight of 436.38 g/mol. Its IUPAC name is [2-[(3-nitrobenzoyl)amino]-2-oxoethyl] 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate.
| Compound Name | [2-[(3-nitrobenzoyl)amino]-2-oxoethyl] 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 2503190 |
| Molecular Formula | C21H16N4O7 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | [2-[(3-nitrobenzoyl)amino]-2-oxoethyl] 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(=O)n3c(nc2c1)CCC3)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16N4O7/c26-18(23-19(27)12-3-1-4-14(9-12)25(30)31)11-32-21(29)13-6-7-15-16(10-13)22-17-5-2-8-24(17)20(15)28/h1,3-4,6-7,9-10H,2,5,8,11H2,(H,23,26,27) |
| InChIKey | JEAXVZBNLVBADF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|