About 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one
2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 25032304) has the molecular formula C16H21BrN4O3
and a molecular weight of 397.27 g/mol. Its IUPAC name is 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 25032304 |
| Molecular Formula | C16H21BrN4O3 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(N)nc2c1cc(Br)c(=O)n2C1CCC(OCCO)CC1 |
| InChI | InChI=1S/C16H21BrN4O3/c1-9-12-8-13(17)15(23)21(14(12)20-16(18)19-9)10-2-4-11(5-3-10)24-7-6-22/h8,10-11,22H,2-7H2,1H3,(H2,18,19,20) |
| InChIKey | LPJUKWATMDFWDN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one (CID 25032304) is 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one is Cc1nc(N)nc2c1cc(Br)c(=O)n2C1CCC(OCCO)CC1.
What is the InChIKey of 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one?
The InChIKey is LPJUKWATMDFWDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrN4O3/c1-9-12-8-13(17)15(23)21(14(12)20-16(18)19-9)10-2-4-11(5-3-10)24-7-6-22/h8,10-11,22H,2-7H2,1H3,(H2,18,19,20).
What are the key properties of 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one?
2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one has a molecular weight of 397.27 g/mol, XLogP of 1.94, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-bromo-8-[4-(2-hydroxyethoxy)cyclohexyl]-4-methylpyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 25032304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).