C25H24N6S2 — CID 25032530
[4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl] N-(3-methylphenyl)carbamodithioate (PubChem CID 25032530) has the molecular formula C25H24N6S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is [4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl] N-(3-methylphenyl)carbamodithioate.
| Compound Name | [4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl] N-(3-methylphenyl)carbamodithioate |
|---|---|
| PubChem CID | 25032530 |
| Molecular Formula | C25H24N6S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl] N-(3-methylphenyl)carbamodithioate |
| SMILES | Cc1cccc(NC(=S)Sc2nc(Nc3cccc(C)c3)nc(Nc3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C25H24N6S2/c1-16-7-4-10-19(13-16)26-22-29-23(27-20-11-5-8-17(2)14-20)31-24(30-22)33-25(32)28-21-12-6-9-18(3)15-21/h4-15H,1-3H3,(H,28,32)(H2,26,27,29,30,31) |
| InChIKey | XSVJOVLRFDWVAL-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|