C31H38O4SSi — CID 25032961
(3S,4R,5R)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(2-hydroxyethyl)-3-phenylsulfanyloxolan-2-one (PubChem CID 25032961) has the molecular formula C31H38O4SSi and a molecular weight of 534.79 g/mol. Its IUPAC name is (3S,4R,5R)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(2-hydroxyethyl)-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(2-hydroxyethyl)-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 25032961 |
| Molecular Formula | C31H38O4SSi |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (3S,4R,5R)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(2-hydroxyethyl)-3-phenylsulfanyloxolan-2-one |
| SMILES | CC(C)(C)[Si](OCCC[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@@H]1CCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H38O4SSi/c1-31(2,3)37(25-16-9-5-10-17-25,26-18-11-6-12-19-26)34-23-13-20-28-27(21-22-32)29(30(33)35-28)36-24-14-7-4-8-15-24/h4-12,14-19,27-29,32H,13,20-23H2,1-3H3/t27-,28-,29+/m1/s1 |
| InChIKey | TWGHIPPCEZNPSK-NLDZOOGBSA-N |
| XLogP | 5.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|