About ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate
ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate (PubChem CID 25032997) has the molecular formula C16H18O3
and a molecular weight of 258.32 g/mol. Its IUPAC name is ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate.
Molecular Properties
| Compound Name | ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate |
| PubChem CID | 25032997 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate |
| SMILES | CCOC(=O)/C1=C(\C)c2ccccc2CCCC1=O |
| InChI | InChI=1S/C16H18O3/c1-3-19-16(18)15-11(2)13-9-5-4-7-12(13)8-6-10-14(15)17/h4-5,7,9H,3,6,8,10H2,1-2H3/b15-11+ |
| InChIKey | QBHTUIVSZCIRIW-RVDMUPIBSA-N |
| XLogP | 2.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate?
The IUPAC name of ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate (CID 25032997) is ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate.
What is the SMILES notation for ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate?
The canonical SMILES for ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate is CCOC(=O)/C1=C(\C)c2ccccc2CCCC1=O.
What is the InChIKey of ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate?
The InChIKey is QBHTUIVSZCIRIW-RVDMUPIBSA-N. The full InChI is InChI=1S/C16H18O3/c1-3-19-16(18)15-11(2)13-9-5-4-7-12(13)8-6-10-14(15)17/h4-5,7,9H,3,6,8,10H2,1-2H3/b15-11+.
What are the key properties of ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate?
ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate has a molecular weight of 258.32 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5E)-5-methyl-7-oxo-9,10-dihydro-8H-benzo[8]annulene-6-carboxylate is sourced from PubChem (CID 25032997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).