C27H27FN6O — CID 25033479
3-(2-azidoethyl)-8-[(1S)-1,2-dihydroacenaphthylen-1-yl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 25033479) has the molecular formula C27H27FN6O and a molecular weight of 470.55 g/mol. Its IUPAC name is 3-(2-azidoethyl)-8-[(1S)-1,2-dihydroacenaphthylen-1-yl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 3-(2-azidoethyl)-8-[(1S)-1,2-dihydroacenaphthylen-1-yl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 25033479 |
| Molecular Formula | C27H27FN6O |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 3-(2-azidoethyl)-8-[(1S)-1,2-dihydroacenaphthylen-1-yl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | [N-]=[N+]=NCCN1CN(c2ccc(F)cc2)C2(CCN([C@H]3Cc4cccc5cccc3c45)CC2)C1=O |
| InChI | InChI=1S/C27H27FN6O/c28-21-7-9-22(10-8-21)34-18-33(16-13-30-31-29)26(35)27(34)11-14-32(15-12-27)24-17-20-5-1-3-19-4-2-6-23(24)25(19)20/h1-10,24H,11-18H2/t24-/m0/s1 |
| InChIKey | VRGQQXOBJFXZIZ-DEOSSOPVSA-N |
| XLogP | 5.03 |
| TPSA | 75.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|