C21H18FNO2 — CID 25033651
5-(3-fluoro-4-methoxyphenyl)-1-pyridin-4-yl-2,3-dihydroinden-1-ol (PubChem CID 25033651) has the molecular formula C21H18FNO2 and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-(3-fluoro-4-methoxyphenyl)-1-pyridin-4-yl-2,3-dihydroinden-1-ol.
| Compound Name | 5-(3-fluoro-4-methoxyphenyl)-1-pyridin-4-yl-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 25033651 |
| Molecular Formula | C21H18FNO2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-(3-fluoro-4-methoxyphenyl)-1-pyridin-4-yl-2,3-dihydroinden-1-ol |
| SMILES | COc1ccc(-c2ccc3c(c2)CCC3(O)c2ccncc2)cc1F |
| InChI | InChI=1S/C21H18FNO2/c1-25-20-5-3-15(13-19(20)22)14-2-4-18-16(12-14)6-9-21(18,24)17-7-10-23-11-8-17/h2-5,7-8,10-13,24H,6,9H2,1H3 |
| InChIKey | VKGRHANZJPGGQL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |