About 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide
4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide (PubChem CID 25033659) has the molecular formula C21H18BrNO2
and a molecular weight of 396.28 g/mol. Its IUPAC name is 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide.
Molecular Properties
| Compound Name | 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide |
| PubChem CID | 25033659 |
| Molecular Formula | C21H18BrNO2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide |
| SMILES | Br.Oc1ccc(-c2ccc3c(c2)CCC=C3c2ccncc2)cc1O |
| InChI | InChI=1S/C21H17NO2.BrH/c23-20-7-5-16(13-21(20)24)15-4-6-19-17(12-15)2-1-3-18(19)14-8-10-22-11-9-14;/h3-13,23-24H,1-2H2;1H |
| InChIKey | JMBWJWVAQBXXJN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide?
The IUPAC name of 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide (CID 25033659) is 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide.
What is the SMILES notation for 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide?
The canonical SMILES for 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide is Br.Oc1ccc(-c2ccc3c(c2)CCC=C3c2ccncc2)cc1O.
What is the InChIKey of 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide?
The InChIKey is JMBWJWVAQBXXJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2.BrH/c23-20-7-5-16(13-21(20)24)15-4-6-19-17(12-15)2-1-3-18(19)14-8-10-22-11-9-14;/h3-13,23-24H,1-2H2;1H.
What are the key properties of 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide?
4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide has a molecular weight of 396.28 g/mol, XLogP of 5.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide is sourced from PubChem (CID 25033659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).