About 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol
4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol (PubChem CID 25033660) has the molecular formula C21H17NO2
and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol |
| PubChem CID | 25033660 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol |
| SMILES | Oc1ccc(-c2ccc3c(c2)CCC=C3c2ccncc2)cc1O |
| InChI | InChI=1S/C21H17NO2/c23-20-7-5-16(13-21(20)24)15-4-6-19-17(12-15)2-1-3-18(19)14-8-10-22-11-9-14/h3-13,23-24H,1-2H2 |
| InChIKey | CLHXFMXKUDGILL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol?
The IUPAC name of 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol (CID 25033660) is 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol.
What is the SMILES notation for 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol?
The canonical SMILES for 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol is Oc1ccc(-c2ccc3c(c2)CCC=C3c2ccncc2)cc1O.
What is the InChIKey of 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol?
The InChIKey is CLHXFMXKUDGILL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2/c23-20-7-5-16(13-21(20)24)15-4-6-19-17(12-15)2-1-3-18(19)14-8-10-22-11-9-14/h3-13,23-24H,1-2H2.
What are the key properties of 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol?
4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol has a molecular weight of 315.37 g/mol, XLogP of 4.54, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-pyridin-4-yl-7,8-dihydronaphthalen-2-yl)benzene-1,2-diol is sourced from PubChem (CID 25033660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).