C15H26O2 — CID 25033702
(1S,2R,5R)-5-methyl-2-[(2S)-2-(4-methylpent-3-enyl)oxiran-2-yl]cyclohexan-1-ol (PubChem CID 25033702) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1S,2R,5R)-5-methyl-2-[(2S)-2-(4-methylpent-3-enyl)oxiran-2-yl]cyclohexan-1-ol.
| Compound Name | (1S,2R,5R)-5-methyl-2-[(2S)-2-(4-methylpent-3-enyl)oxiran-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 25033702 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1S,2R,5R)-5-methyl-2-[(2S)-2-(4-methylpent-3-enyl)oxiran-2-yl]cyclohexan-1-ol |
| SMILES | CC(C)=CCC[C@]1([C@@H]2CC[C@@H](C)C[C@@H]2O)CO1 |
| InChI | InChI=1S/C15H26O2/c1-11(2)5-4-8-15(10-17-15)13-7-6-12(3)9-14(13)16/h5,12-14,16H,4,6-10H2,1-3H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | GMGGHMSKPBANOW-APIJFGDWSA-N |
| XLogP | 3.30 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|