C21H20BrNO2 — CID 25033727
4-(5-pyridin-4-yl-5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide (PubChem CID 25033727) has the molecular formula C21H20BrNO2 and a molecular weight of 398.30 g/mol. Its IUPAC name is 4-(5-pyridin-4-yl-5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide.
| Compound Name | 4-(5-pyridin-4-yl-5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide |
|---|---|
| PubChem CID | 25033727 |
| Molecular Formula | C21H20BrNO2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-(5-pyridin-4-yl-5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,2-diol;hydrobromide |
| SMILES | Br.Oc1ccc(-c2ccc3c(c2)CCCC3c2ccncc2)cc1O |
| InChI | InChI=1S/C21H19NO2.BrH/c23-20-7-5-16(13-21(20)24)15-4-6-19-17(12-15)2-1-3-18(19)14-8-10-22-11-9-14;/h4-13,18,23-24H,1-3H2;1H |
| InChIKey | PYVRRGZFIYKCIN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|