About 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride
4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride (PubChem CID 25033734) has the molecular formula C21H17ClFN
and a molecular weight of 337.83 g/mol. Its IUPAC name is 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride |
| PubChem CID | 25033734 |
| Molecular Formula | C21H17ClFN |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride |
| SMILES | Cl.Fc1ccc(-c2ccc3c(c2)CCC=C3c2ccncc2)cc1 |
| InChI | InChI=1S/C21H16FN.ClH/c22-19-7-4-15(5-8-19)17-6-9-21-18(14-17)2-1-3-20(21)16-10-12-23-13-11-16;/h3-14H,1-2H2;1H |
| InChIKey | NPTYKZWLTCILPL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride?
The IUPAC name of 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride (CID 25033734) is 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride.
What is the SMILES notation for 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride?
The canonical SMILES for 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride is Cl.Fc1ccc(-c2ccc3c(c2)CCC=C3c2ccncc2)cc1.
What is the InChIKey of 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride?
The InChIKey is NPTYKZWLTCILPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16FN.ClH/c22-19-7-4-15(5-8-19)17-6-9-21-18(14-17)2-1-3-20(21)16-10-12-23-13-11-16;/h3-14H,1-2H2;1H.
What are the key properties of 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride?
4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride has a molecular weight of 337.83 g/mol, XLogP of 5.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(4-fluorophenyl)-3,4-dihydronaphthalen-1-yl]pyridine;hydrochloride is sourced from PubChem (CID 25033734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).