C17H18Cl2N4O4S — CID 25033953
(1R)-1-[(4R,5R)-5-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol (PubChem CID 25033953) has the molecular formula C17H18Cl2N4O4S and a molecular weight of 445.33 g/mol. Its IUPAC name is (1R)-1-[(4R,5R)-5-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(4R,5R)-5-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 25033953 |
| Molecular Formula | C17H18Cl2N4O4S |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | (1R)-1-[(4R,5R)-5-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
| SMILES | CC1(C)O[C@H]([C@H](O)CO)[C@@H](c2nnc3n2N=C(c2ccc(Cl)cc2Cl)CS3)O1 |
| InChI | InChI=1S/C17H18Cl2N4O4S/c1-17(2)26-13(12(25)6-24)14(27-17)15-20-21-16-23(15)22-11(7-28-16)9-4-3-8(18)5-10(9)19/h3-5,12-14,24-25H,6-7H2,1-2H3/t12-,13-,14+/m1/s1 |
| InChIKey | SENOOIBRBKNTRX-MCIONIFRSA-N |
| XLogP | 2.49 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |