C25H27NO7 — CID 25033976
methyl (3aR,6R,6aS)-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-6-(phenylmethoxymethyl)-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate (PubChem CID 25033976) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is methyl (3aR,6R,6aS)-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-6-(phenylmethoxymethyl)-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate.
| Compound Name | methyl (3aR,6R,6aS)-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-6-(phenylmethoxymethyl)-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 25033976 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | methyl (3aR,6R,6aS)-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-6-(phenylmethoxymethyl)-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate |
| SMILES | COC(=O)[C@]1(COCc2ccccc2)N(Cc2ccc(OC)cc2)C(=O)[C@@H]2CC(=O)O[C@@]21C |
| InChI | InChI=1S/C25H27NO7/c1-24-20(13-21(27)33-24)22(28)26(14-17-9-11-19(30-2)12-10-17)25(24,23(29)31-3)16-32-15-18-7-5-4-6-8-18/h4-12,20H,13-16H2,1-3H3/t20-,24-,25-/m0/s1 |
| InChIKey | OCWNTPGBLJQWHI-OPXMRZJTSA-N |
| XLogP | 2.49 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |